C23H28O7 — CID 134613040
[2-(3,5-dihydroxyphenyl)-2-oxoethyl] 5-(2-methoxy-5-methylphenoxy)-2,2-dimethylpentanoate (PubChem CID 134613040) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-(3,5-dihydroxyphenyl)-2-oxoethyl] 5-(2-methoxy-5-methylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | [2-(3,5-dihydroxyphenyl)-2-oxoethyl] 5-(2-methoxy-5-methylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 134613040 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [2-(3,5-dihydroxyphenyl)-2-oxoethyl] 5-(2-methoxy-5-methylphenoxy)-2,2-dimethylpentanoate |
| SMILES | COc1ccc(C)cc1OCCCC(C)(C)C(=O)OCC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C23H28O7/c1-15-6-7-20(28-4)21(10-15)29-9-5-8-23(2,3)22(27)30-14-19(26)16-11-17(24)13-18(25)12-16/h6-7,10-13,24-25H,5,8-9,14H2,1-4H3 |
| InChIKey | BODSBCBNKNYLKR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|