About 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride
4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride (PubChem CID 134691146) has the molecular formula C8H14ClNO
and a molecular weight of 175.66 g/mol. Its IUPAC name is 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride.
Analyze 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride?
The IUPAC name of 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride (CID 134691146) is 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride.
What is the SMILES notation for 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride?
The canonical SMILES for 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride is Cl.NC1C2CC3COC1C3C2.
What is the InChIKey of 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride?
The InChIKey is HSMDRSVFKVIOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.ClH/c9-7-4-1-5-3-10-8(7)6(5)2-4;/h4-8H,1-3,9H2;1H.
What are the key properties of 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride?
4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride has a molecular weight of 175.66 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatricyclo[4.2.1.03,7]nonan-2-amine;hydrochloride is sourced from PubChem (CID 134691146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).