C8H13NO — CID 12850951
4-oxatricyclo[4.2.1.03,7]nonan-2-amine (PubChem CID 12850951) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-oxatricyclo[4.2.1.03,7]nonan-2-amine.
| Compound Name | 4-oxatricyclo[4.2.1.03,7]nonan-2-amine |
|---|---|
| PubChem CID | 12850951 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-oxatricyclo[4.2.1.03,7]nonan-2-amine |
| SMILES | NC1C2CC3COC1C3C2 |
| InChI | InChI=1S/C8H13NO/c9-7-4-1-5-3-10-8(7)6(5)2-4/h4-8H,1-3,9H2 |
| InChIKey | JPCBVKFUWMYCBT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |