C17H25N5O2S — CID 134711398
N-[3-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]propyl]-4-methylbenzenesulfonamide (PubChem CID 134711398) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[3-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134711398 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[3-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNc2ncc(C)c(N(C)C)n2)cc1 |
| InChI | InChI=1S/C17H25N5O2S/c1-13-6-8-15(9-7-13)25(23,24)20-11-5-10-18-17-19-12-14(2)16(21-17)22(3)4/h6-9,12,20H,5,10-11H2,1-4H3,(H,18,19,21) |
| InChIKey | JEMVTVPYKCZHRK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|