C20H28F3N3O3 — CID 134786645
(4aR,6R,7S,7aS)-3,3-dimethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-6,7a-diol (PubChem CID 134786645) has the molecular formula C20H28F3N3O3 and a molecular weight of 415.46 g/mol. Its IUPAC name is (4aR,6R,7S,7aS)-3,3-dimethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-6,7a-diol.
| Compound Name | (4aR,6R,7S,7aS)-3,3-dimethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-6,7a-diol |
|---|---|
| PubChem CID | 134786645 |
| Molecular Formula | C20H28F3N3O3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (4aR,6R,7S,7aS)-3,3-dimethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-6,7a-diol |
| SMILES | CC1(C)C[C@H]2C[C@@H](O)[C@H](N3CCN(c4ccc(C(F)(F)F)cn4)CC3)[C@]2(O)CO1 |
| InChI | InChI=1S/C20H28F3N3O3/c1-18(2)10-14-9-15(27)17(19(14,28)12-29-18)26-7-5-25(6-8-26)16-4-3-13(11-24-16)20(21,22)23/h3-4,11,14-15,17,27-28H,5-10,12H2,1-2H3/t14-,15-,17+,19+/m1/s1 |
| InChIKey | RCMQTRRYPIEJMP-RRIFGTCXSA-N |
| XLogP | 1.90 |
| TPSA | 69.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |