C30H53NO5Si — CID 134832514
tert-butyl N-[3-[(6R)-2-phenylmethoxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]propyl]carbamate (PubChem CID 134832514) has the molecular formula C30H53NO5Si and a molecular weight of 535.84 g/mol. Its IUPAC name is tert-butyl N-[3-[(6R)-2-phenylmethoxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6R)-2-phenylmethoxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 134832514 |
| Molecular Formula | C30H53NO5Si |
| Molecular Weight | 535.84 g/mol |
| Exact Mass | 535.37 |
| IUPAC Name | tert-butyl N-[3-[(6R)-2-phenylmethoxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]propyl]carbamate |
| SMILES | CC(C)[Si](OC[C@H]1CCC(CCCNC(=O)OC(C)(C)C)C(OCc2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H53NO5Si/c1-22(2)37(23(3)4,24(5)6)34-21-27-18-17-26(16-13-19-31-29(32)36-30(7,8)9)28(35-27)33-20-25-14-11-10-12-15-25/h10-12,14-15,22-24,26-28H,13,16-21H2,1-9H3,(H,31,32)/t26?,27-,28?/m1/s1 |
| InChIKey | QWXYSMBWLKXBTB-QBYNGQAISA-N |
| XLogP | 7.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.84 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|