C37H32N2O4 — CID 134844137
methyl (4R,4aS,5R,12cS)-1-benzyl-2-methyl-7-oxo-4,5-diphenyl-4a,5,6,12c-tetrahydro-4H-chromeno[3,4-h][1,6]naphthyridine-3-carboxylate (PubChem CID 134844137) has the molecular formula C37H32N2O4 and a molecular weight of 568.67 g/mol. Its IUPAC name is methyl (4R,4aS,5R,12cS)-1-benzyl-2-methyl-7-oxo-4,5-diphenyl-4a,5,6,12c-tetrahydro-4H-chromeno[3,4-h][1,6]naphthyridine-3-carboxylate.
| Compound Name | methyl (4R,4aS,5R,12cS)-1-benzyl-2-methyl-7-oxo-4,5-diphenyl-4a,5,6,12c-tetrahydro-4H-chromeno[3,4-h][1,6]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 134844137 |
| Molecular Formula | C37H32N2O4 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | methyl (4R,4aS,5R,12cS)-1-benzyl-2-methyl-7-oxo-4,5-diphenyl-4a,5,6,12c-tetrahydro-4H-chromeno[3,4-h][1,6]naphthyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)[C@@H]2c3c(c(=O)oc4ccccc34)N[C@@H](c3ccccc3)[C@@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C37H32N2O4/c1-23-29(36(40)42-2)30(25-16-8-4-9-17-25)32-33(26-18-10-5-11-19-26)38-34-31(27-20-12-13-21-28(27)43-37(34)41)35(32)39(23)22-24-14-6-3-7-15-24/h3-21,30,32-33,35,38H,22H2,1-2H3/t30-,32+,33+,35-/m1/s1 |
| InChIKey | COVOYYATPPFNIK-MDQANTRUSA-N |
| XLogP | 7.36 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|