C34H58O8Si2 — CID 134852541
ethyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 134852541) has the molecular formula C34H58O8Si2 and a molecular weight of 651.00 g/mol. Its IUPAC name is ethyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | ethyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 134852541 |
| Molecular Formula | C34H58O8Si2 |
| Molecular Weight | 651.00 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | ethyl 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@@H]2O[C@@H]3[C@@H](O[C@H](COCc4ccccc4)[C@@H]3O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C34H58O8Si2/c1-12-37-27(35)20-24-18-19-25-28(38-24)32(42-44(10,11)34(5,6)7)31-30(39-25)29(41-43(8,9)33(2,3)4)26(40-31)22-36-21-23-16-14-13-15-17-23/h13-17,24-26,28-32H,12,18-22H2,1-11H3/t24-,25+,26-,28+,29+,30+,31-,32+/m1/s1 |
| InChIKey | FZLRWJBFWZQSNV-IKCVFFNYSA-N |
| XLogP | 7.02 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.00 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|