C23H39IO3Si — CID 134856275
tert-butyl-[(2R,3S,4R)-1-iodo-2-methyl-4-[(2S,4S,5S)-5-methyl-2-phenyl-1,3-dioxan-4-yl]pentan-3-yl]oxy-dimethylsilane (PubChem CID 134856275) has the molecular formula C23H39IO3Si and a molecular weight of 518.55 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4R)-1-iodo-2-methyl-4-[(2S,4S,5S)-5-methyl-2-phenyl-1,3-dioxan-4-yl]pentan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,4R)-1-iodo-2-methyl-4-[(2S,4S,5S)-5-methyl-2-phenyl-1,3-dioxan-4-yl]pentan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134856275 |
| Molecular Formula | C23H39IO3Si |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | tert-butyl-[(2R,3S,4R)-1-iodo-2-methyl-4-[(2S,4S,5S)-5-methyl-2-phenyl-1,3-dioxan-4-yl]pentan-3-yl]oxy-dimethylsilane |
| SMILES | C[C@H]([C@H]1O[C@@H](c2ccccc2)OC[C@@H]1C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CI |
| InChI | InChI=1S/C23H39IO3Si/c1-16(14-24)21(27-28(7,8)23(4,5)6)18(3)20-17(2)15-25-22(26-20)19-12-10-9-11-13-19/h9-13,16-18,20-22H,14-15H2,1-8H3/t16-,17-,18+,20-,21+,22-/m0/s1 |
| InChIKey | FZWMYEUVEROYLD-GDRZYPCOSA-N |
| XLogP | 6.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|