About dimagnesium;phenylazanidylmethanedithioate;dibromide
dimagnesium;phenylazanidylmethanedithioate;dibromide (PubChem CID 134871517) has the molecular formula C7H5Br2Mg2NS2
and a molecular weight of 375.68 g/mol. Its IUPAC name is dimagnesium;phenylazanidylmethanedithioate;dibromide.
Molecular Properties
| Compound Name | dimagnesium;phenylazanidylmethanedithioate;dibromide |
| PubChem CID | 134871517 |
| Molecular Formula | C7H5Br2Mg2NS2 |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 372.79 |
| IUPAC Name | dimagnesium;phenylazanidylmethanedithioate;dibromide |
| SMILES | S=C([S-])[N-]c1ccccc1.[Br-].[Br-].[Mg+2].[Mg+2] |
| InChI | InChI=1S/C7H7NS2.2BrH.2Mg/c9-7(10)8-6-4-2-1-3-5-6;;;;/h1-5H,(H2,8,9,10);2*1H;;/q;;;2*+2/p-4 |
| InChIKey | NTHILSHVMJHNML-UHFFFAOYSA-J |
| XLogP | -4.23 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dimagnesium;phenylazanidylmethanedithioate;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;phenylazanidylmethanedithioate;dibromide?
The IUPAC name of dimagnesium;phenylazanidylmethanedithioate;dibromide (CID 134871517) is dimagnesium;phenylazanidylmethanedithioate;dibromide.
What is the SMILES notation for dimagnesium;phenylazanidylmethanedithioate;dibromide?
The canonical SMILES for dimagnesium;phenylazanidylmethanedithioate;dibromide is S=C([S-])[N-]c1ccccc1.[Br-].[Br-].[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;phenylazanidylmethanedithioate;dibromide?
The InChIKey is NTHILSHVMJHNML-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H7NS2.2BrH.2Mg/c9-7(10)8-6-4-2-1-3-5-6;;;;/h1-5H,(H2,8,9,10);2*1H;;/q;;;2*+2/p-4.
What are the key properties of dimagnesium;phenylazanidylmethanedithioate;dibromide?
dimagnesium;phenylazanidylmethanedithioate;dibromide has a molecular weight of 375.68 g/mol, XLogP of -4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;phenylazanidylmethanedithioate;dibromide is sourced from PubChem (CID 134871517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).