C30H44N2O4Si — CID 134876682
(3R)-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-bis(phenylmethoxy)butyl]-2-propan-2-ylidene-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134876682) has the molecular formula C30H44N2O4Si and a molecular weight of 524.78 g/mol. Its IUPAC name is (3R)-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-bis(phenylmethoxy)butyl]-2-propan-2-ylidene-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (3R)-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-bis(phenylmethoxy)butyl]-2-propan-2-ylidene-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134876682 |
| Molecular Formula | C30H44N2O4Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | (3R)-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-bis(phenylmethoxy)butyl]-2-propan-2-ylidene-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CC(C)=[N+]1N=C([O-])C[C@H]1C[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44N2O4Si/c1-23(2)32-26(19-29(33)31-32)18-27(35-21-25-16-12-9-13-17-25)28(36-37(6,7)30(3,4)5)22-34-20-24-14-10-8-11-15-24/h8-17,26-28H,18-22H2,1-7H3/t26-,27+,28-/m1/s1 |
| InChIKey | PAITVUOPKDIIRZ-OZNIXHKMSA-N |
| XLogP | 5.51 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|