C7H15LiN2 — CID 134881469
lithium (2,4-dimethylpentan-3-ylideneamino)azanide (PubChem CID 134881469) has the molecular formula C7H15LiN2 and a molecular weight of 134.15 g/mol. Its IUPAC name is lithium (2,4-dimethylpentan-3-ylideneamino)azanide.
| Compound Name | lithium (2,4-dimethylpentan-3-ylideneamino)azanide |
|---|---|
| PubChem CID | 134881469 |
| Molecular Formula | C7H15LiN2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.14 |
| IUPAC Name | lithium (2,4-dimethylpentan-3-ylideneamino)azanide |
| SMILES | CC(C)C(=N[NH-])C(C)C.[Li+] |
| InChI | InChI=1S/C7H15N2.Li/c1-5(2)7(9-8)6(3)4;/h5-6,8H,1-4H3;/q-1;+1 |
| InChIKey | OFAGNVMFBUFJTL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|