C30H50O5 — CID 134883009
(2S,3S)-3-(1-ethoxyethoxymethyl)-2-methyl-2-[2-[(2R,3R)-3-(3-octoxy-4-phenylbutyl)oxiran-2-yl]ethyl]oxirane (PubChem CID 134883009) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is (2S,3S)-3-(1-ethoxyethoxymethyl)-2-methyl-2-[2-[(2R,3R)-3-(3-octoxy-4-phenylbutyl)oxiran-2-yl]ethyl]oxirane.
| Compound Name | (2S,3S)-3-(1-ethoxyethoxymethyl)-2-methyl-2-[2-[(2R,3R)-3-(3-octoxy-4-phenylbutyl)oxiran-2-yl]ethyl]oxirane |
|---|---|
| PubChem CID | 134883009 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | (2S,3S)-3-(1-ethoxyethoxymethyl)-2-methyl-2-[2-[(2R,3R)-3-(3-octoxy-4-phenylbutyl)oxiran-2-yl]ethyl]oxirane |
| SMILES | CCCCCCCCOC(CC[C@H]1O[C@@H]1CC[C@]1(C)O[C@H]1COC(C)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C30H50O5/c1-5-7-8-9-10-14-21-32-26(22-25-15-12-11-13-16-25)17-18-27-28(34-27)19-20-30(4)29(35-30)23-33-24(3)31-6-2/h11-13,15-16,24,26-29H,5-10,14,17-23H2,1-4H3/t24?,26?,27-,28-,29+,30+/m1/s1 |
| InChIKey | FISKPPYIGPOOGN-XSTJLYEKSA-N |
| XLogP | 6.86 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|