C13H18ClNO5 — CID 134914041
diethyl 5-hydroxy-1,6-dimethylpyridin-1-ium-3,4-dicarboxylate chloride (PubChem CID 134914041) has the molecular formula C13H18ClNO5 and a molecular weight of 303.74 g/mol. Its IUPAC name is diethyl 5-hydroxy-1,6-dimethylpyridin-1-ium-3,4-dicarboxylate chloride.
| Compound Name | diethyl 5-hydroxy-1,6-dimethylpyridin-1-ium-3,4-dicarboxylate chloride |
|---|---|
| PubChem CID | 134914041 |
| Molecular Formula | C13H18ClNO5 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | diethyl 5-hydroxy-1,6-dimethylpyridin-1-ium-3,4-dicarboxylate chloride |
| SMILES | CCOC(=O)c1c[n+](C)c(C)c(O)c1C(=O)OCC.[Cl-] |
| InChI | InChI=1S/C13H17NO5.ClH/c1-5-18-12(16)9-7-14(4)8(3)11(15)10(9)13(17)19-6-2;/h7H,5-6H2,1-4H3;1H |
| InChIKey | RDQOJWJHYPLSOE-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|