C26H29ClN2O8 — CID 134929177
N-tert-butyl-7-chloro-4-(dimethylamino)-6-hydroperoxy-1,12a-dihydroxy-6-methyl-3,11,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 134929177) has the molecular formula C26H29ClN2O8 and a molecular weight of 532.98 g/mol. Its IUPAC name is N-tert-butyl-7-chloro-4-(dimethylamino)-6-hydroperoxy-1,12a-dihydroxy-6-methyl-3,11,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | N-tert-butyl-7-chloro-4-(dimethylamino)-6-hydroperoxy-1,12a-dihydroxy-6-methyl-3,11,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134929177 |
| Molecular Formula | C26H29ClN2O8 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | N-tert-butyl-7-chloro-4-(dimethylamino)-6-hydroperoxy-1,12a-dihydroxy-6-methyl-3,11,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(=O)NC(C)(C)C)=C(O)C2(O)C(=O)C3=C(CC12)C(C)(OO)c1c(Cl)cccc1C3=O |
| InChI | InChI=1S/C26H29ClN2O8/c1-24(2,3)28-23(34)16-20(31)18(29(5)6)13-10-12-15(21(32)26(13,35)22(16)33)19(30)11-8-7-9-14(27)17(11)25(12,4)37-36/h7-9,13,18,33,35-36H,10H2,1-6H3,(H,28,34) |
| InChIKey | CUUCZSAMBIQTGA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|