C29H32O6SSi — CID 134936342
(3'aR,4S,7'S,7'aR)-2,2,2'-trimethyl-7'-triphenylsilyloxyspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-thiol (PubChem CID 134936342) has the molecular formula C29H32O6SSi and a molecular weight of 536.72 g/mol. Its IUPAC name is (3'aR,4S,7'S,7'aR)-2,2,2'-trimethyl-7'-triphenylsilyloxyspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-thiol.
| Compound Name | (3'aR,4S,7'S,7'aR)-2,2,2'-trimethyl-7'-triphenylsilyloxyspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-thiol |
|---|---|
| PubChem CID | 134936342 |
| Molecular Formula | C29H32O6SSi |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (3'aR,4S,7'S,7'aR)-2,2,2'-trimethyl-7'-triphenylsilyloxyspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-thiol |
| SMILES | CC1O[C@@H]2[C@@H](CO[C@]3(COC(C)(C)O3)[C@]2(S)O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C29H32O6SSi/c1-21-32-25-19-30-28(20-31-27(2,3)34-28)29(36,26(25)33-21)35-37(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,21,25-26,36H,19-20H2,1-3H3/t21?,25-,26-,28+,29+/m1/s1 |
| InChIKey | UHSDABHBSCSSCY-GEOVRIEQSA-N |
| XLogP | 2.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|