C26H38O5SSi — CID 134938185
tert-butyl-dimethyl-[(2R)-1-[2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]propan-2-yl]oxysilane (PubChem CID 134938185) has the molecular formula C26H38O5SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-1-[2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]propan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R)-1-[2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 134938185 |
| Molecular Formula | C26H38O5SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-1-[2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]propan-2-yl]oxysilane |
| SMILES | Cc1ccc(S(=O)(=O)C2(C[C@@H](C)O[Si](C)(C)C(C)(C)C)OC2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H38O5SSi/c1-20-13-15-23(16-14-20)32(27,28)26(17-21(2)31-33(6,7)25(3,4)5)24(30-26)19-29-18-22-11-9-8-10-12-22/h8-16,21,24H,17-19H2,1-7H3/t21-,24?,26?/m1/s1 |
| InChIKey | GXPIKXCBWFJKDX-NGYDJQAMSA-N |
| XLogP | 5.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|