C35H54O7S2Si — CID 135021154
tert-butyl-[(1R)-1-[(4R,5R,6S)-6-[(S)-1,3-dithian-2-yl(phenylmethoxy)methyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane (PubChem CID 135021154) has the molecular formula C35H54O7S2Si and a molecular weight of 679.03 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(4R,5R,6S)-6-[(S)-1,3-dithian-2-yl(phenylmethoxy)methyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(4R,5R,6S)-6-[(S)-1,3-dithian-2-yl(phenylmethoxy)methyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135021154 |
| Molecular Formula | C35H54O7S2Si |
| Molecular Weight | 679.03 g/mol |
| Exact Mass | 678.31 |
| IUPAC Name | tert-butyl-[(1R)-1-[(4R,5R,6S)-6-[(S)-1,3-dithian-2-yl(phenylmethoxy)methyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2,2-dimethoxyethoxy]-dimethylsilane |
| SMILES | COC(OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]([C@H](OCc2ccccc2)C2SCCCS2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H54O7S2Si/c1-34(2,3)45(8,9)42-30(32(36-6)37-7)28-27(38-23-25-17-12-10-13-18-25)29(41-35(4,5)40-28)31(33-43-21-16-22-44-33)39-24-26-19-14-11-15-20-26/h10-15,17-20,27-33H,16,21-24H2,1-9H3/t27-,28+,29-,30+,31-/m0/s1 |
| InChIKey | SQPMKJMDZNLOKT-LIIQBVBMSA-N |
| XLogP | 7.88 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.03 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|