C22H38O3Si — CID 135021700
methyl (2E,6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,10,12-tetraenoate (PubChem CID 135021700) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is methyl (2E,6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,10,12-tetraenoate.
| Compound Name | methyl (2E,6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 135021700 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | methyl (2E,6R,8E,10Z,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,10,12-tetraenoate |
| SMILES | COC(=O)/C=C/CC[C@@H](C)C/C=C/C=C\C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-20(17-13-14-18-21(23)24-5)16-12-10-8-9-11-15-19-25-26(6,7)22(2,3)4/h8-12,14-15,18,20H,13,16-17,19H2,1-7H3/b9-8-,12-10+,15-11+,18-14+/t20-/m0/s1 |
| InChIKey | MKJYJQZHFRDCNH-PVZAZIPXSA-N |
| XLogP | 6.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|