C26H30N2O — CID 135050232
(E)-1-[[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-methylamino]-3-phenylprop-2-en-1-ol (PubChem CID 135050232) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (E)-1-[[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-methylamino]-3-phenylprop-2-en-1-ol.
| Compound Name | (E)-1-[[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-methylamino]-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 135050232 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (E)-1-[[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-methylamino]-3-phenylprop-2-en-1-ol |
| SMILES | CN(C)[C@@H](c1ccccc1)[C@H](c1ccccc1)N(C)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H30N2O/c1-27(2)25(22-15-9-5-10-16-22)26(23-17-11-6-12-18-23)28(3)24(29)20-19-21-13-7-4-8-14-21/h4-20,24-26,29H,1-3H3/b20-19+/t24?,25-,26-/m0/s1 |
| InChIKey | GRPZYGQREWZVFH-ZDJMANKXSA-N |
| XLogP | 4.99 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|