C28H50O5Si2 — CID 135073358
2-[[2-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enyl]-5-(2-trimethylsilylethoxymethoxy)phenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 135073358) has the molecular formula C28H50O5Si2 and a molecular weight of 522.88 g/mol. Its IUPAC name is 2-[[2-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enyl]-5-(2-trimethylsilylethoxymethoxy)phenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enyl]-5-(2-trimethylsilylethoxymethoxy)phenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135073358 |
| Molecular Formula | C28H50O5Si2 |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 2-[[2-[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enyl]-5-(2-trimethylsilylethoxymethoxy)phenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C/C(=C\Cc1ccc(OCOCC[Si](C)(C)C)cc1OCOCC[Si](C)(C)C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C28H50O5Si2/c1-23(11-15-27-28(2,3)33-27)10-12-24-13-14-25(31-21-29-16-18-34(4,5)6)20-26(24)32-22-30-17-19-35(7,8)9/h10,13-14,20,27H,11-12,15-19,21-22H2,1-9H3/b23-10+/t27-/m1/s1 |
| InChIKey | MEHGBUZKMUXPBL-AGKRTQFKSA-N |
| XLogP | 7.52 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|