C20H15F2NO2 — CID 135152901
6-(4,4-difluoro-3,3-dimethylisoquinolin-1-yl)chromen-4-one (PubChem CID 135152901) has the molecular formula C20H15F2NO2 and a molecular weight of 339.34 g/mol. Its IUPAC name is 6-(4,4-difluoro-3,3-dimethylisoquinolin-1-yl)chromen-4-one.
| Compound Name | 6-(4,4-difluoro-3,3-dimethylisoquinolin-1-yl)chromen-4-one |
|---|---|
| PubChem CID | 135152901 |
| Molecular Formula | C20H15F2NO2 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-(4,4-difluoro-3,3-dimethylisoquinolin-1-yl)chromen-4-one |
| SMILES | CC1(C)N=C(c2ccc3occc(=O)c3c2)c2ccccc2C1(F)F |
| InChI | InChI=1S/C20H15F2NO2/c1-19(2)20(21,22)15-6-4-3-5-13(15)18(23-19)12-7-8-17-14(11-12)16(24)9-10-25-17/h3-11H,1-2H3 |
| InChIKey | XMACHCPENCZIKL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |