C37H50O8 — CID 135172609
2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[3-methyl-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenoxy]ethyl 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 135172609) has the molecular formula C37H50O8 and a molecular weight of 622.80 g/mol. Its IUPAC name is 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[3-methyl-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenoxy]ethyl 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[3-methyl-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenoxy]ethyl 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135172609 |
| Molecular Formula | C37H50O8 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-5-[3-methyl-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenoxy]ethyl 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(C)(C)CO)cc(-c2ccc(C3CCC(CC/C=C/C)CC3)c(C)c2)c1 |
| InChI | InChI=1S/C37H50O8/c1-6-7-8-9-28-10-12-29(13-11-28)34-15-14-30(20-26(34)2)31-21-32(42-16-18-44-35(40)27(3)24-38)23-33(22-31)43-17-19-45-36(41)37(4,5)25-39/h6-7,14-15,20-23,28-29,38-39H,3,8-13,16-19,24-25H2,1-2,4-5H3/b7-6+ |
| InChIKey | HUYKKASYWLZUFC-VOTSOKGWSA-N |
| XLogP | 6.70 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|