C20H36N4O6S2 — CID 135188439
N-[1-[[(3R)-6-(carbamoylamino)-2-oxo-1-sulfanylhexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-ethenylsulfonylhexanamide (PubChem CID 135188439) has the molecular formula C20H36N4O6S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-[1-[[(3R)-6-(carbamoylamino)-2-oxo-1-sulfanylhexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-ethenylsulfonylhexanamide.
| Compound Name | N-[1-[[(3R)-6-(carbamoylamino)-2-oxo-1-sulfanylhexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-ethenylsulfonylhexanamide |
|---|---|
| PubChem CID | 135188439 |
| Molecular Formula | C20H36N4O6S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-[1-[[(3R)-6-(carbamoylamino)-2-oxo-1-sulfanylhexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-ethenylsulfonylhexanamide |
| SMILES | C=CS(=O)(=O)CCCCCC(=O)NC(C(=O)N[C@H](CCCNC(N)=O)C(=O)CS)C(C)C |
| InChI | InChI=1S/C20H36N4O6S2/c1-4-32(29,30)12-7-5-6-10-17(26)24-18(14(2)3)19(27)23-15(16(25)13-31)9-8-11-22-20(21)28/h4,14-15,18,31H,1,5-13H2,2-3H3,(H,23,27)(H,24,26)(H3,21,22,28)/t15-,18?/m1/s1 |
| InChIKey | XTPINRCYWXXBED-NNJIEVJOSA-N |
| XLogP | 0.68 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|