C16H16N2O — CID 135224329
[2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-imidazol-5-yl]-phenylmethanone (PubChem CID 135224329) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-imidazol-5-yl]-phenylmethanone.
| Compound Name | [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-imidazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135224329 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-imidazol-5-yl]-phenylmethanone |
| SMILES | C/C=C\C(=C/C)c1ncc(C(=O)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H16N2O/c1-3-8-12(4-2)16-17-11-14(18-16)15(19)13-9-6-5-7-10-13/h3-11H,1-2H3,(H,17,18)/b8-3-,12-4+ |
| InChIKey | AVSJIUKUSIJUFB-KNZHWYAJSA-N |
| XLogP | 3.62 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|