C15H27NS — CID 135265914
1,1,2,4-tetramethyl-6-[(Z)-3-methylhex-3-enyl]-4H-1,3-thiazine (PubChem CID 135265914) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 1,1,2,4-tetramethyl-6-[(Z)-3-methylhex-3-enyl]-4H-1,3-thiazine.
| Compound Name | 1,1,2,4-tetramethyl-6-[(Z)-3-methylhex-3-enyl]-4H-1,3-thiazine |
|---|---|
| PubChem CID | 135265914 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1,1,2,4-tetramethyl-6-[(Z)-3-methylhex-3-enyl]-4H-1,3-thiazine |
| SMILES | CC/C=C(/C)CCC1=CC(C)N=C(C)S1(C)C |
| InChI | InChI=1S/C15H27NS/c1-7-8-12(2)9-10-15-11-13(3)16-14(4)17(15,5)6/h8,11,13H,7,9-10H2,1-6H3/b12-8- |
| InChIKey | LLMITRJOCOVJQU-WQLSENKSSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|