C13H19NO2 — CID 135272623
4a,8,8-trimethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile (PubChem CID 135272623) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4a,8,8-trimethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile.
| Compound Name | 4a,8,8-trimethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 135272623 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4a,8,8-trimethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile |
| SMILES | CC12CCCOC1C(C)(C)C(=O)C(C#N)C2 |
| InChI | InChI=1S/C13H19NO2/c1-12(2)10(15)9(8-14)7-13(3)5-4-6-16-11(12)13/h9,11H,4-7H2,1-3H3 |
| InChIKey | NLSRNPZRWXGDSF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|