C14H21NO2 — CID 162497673
(2R,4aS,8aR)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile (PubChem CID 162497673) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R,4aS,8aR)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile.
| Compound Name | (2R,4aS,8aR)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 162497673 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2R,4aS,8aR)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,5,6,8a-hexahydrochromene-6-carbonitrile |
| SMILES | C[C@@H]1CC[C@@]2(C)CC(C#N)C(=O)C(C)(C)[C@@H]2O1 |
| InChI | InChI=1S/C14H21NO2/c1-9-5-6-14(4)7-10(8-15)11(16)13(2,3)12(14)17-9/h9-10,12H,5-7H2,1-4H3/t9-,10?,12+,14+/m1/s1 |
| InChIKey | BDTITWZDWDPHRB-OHGXHIJCSA-N |
| XLogP | 2.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|