About sodium;chloroform;octadecanoate
sodium;chloroform;octadecanoate (PubChem CID 135326367) has the molecular formula C19H36Cl3NaO2
and a molecular weight of 425.84 g/mol. Its IUPAC name is sodium;chloroform;octadecanoate.
Molecular Properties
| Compound Name | sodium;chloroform;octadecanoate |
| PubChem CID | 135326367 |
| Molecular Formula | C19H36Cl3NaO2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | sodium;chloroform;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].ClC(Cl)Cl.[Na+] |
| InChI | InChI=1S/C18H36O2.CHCl3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;/h2-17H2,1H3,(H,19,20);1H;/q;;+1/p-1 |
| InChIKey | MCWDCVSKPUWFLC-UHFFFAOYSA-M |
| XLogP | 3.99 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;chloroform;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloroform;octadecanoate?
The IUPAC name of sodium;chloroform;octadecanoate (CID 135326367) is sodium;chloroform;octadecanoate.
What is the SMILES notation for sodium;chloroform;octadecanoate?
The canonical SMILES for sodium;chloroform;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].ClC(Cl)Cl.[Na+].
What is the InChIKey of sodium;chloroform;octadecanoate?
The InChIKey is MCWDCVSKPUWFLC-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.CHCl3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;/h2-17H2,1H3,(H,19,20);1H;/q;;+1/p-1.
What are the key properties of sodium;chloroform;octadecanoate?
sodium;chloroform;octadecanoate has a molecular weight of 425.84 g/mol, XLogP of 3.99, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloroform;octadecanoate is sourced from PubChem (CID 135326367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).