C10H7N2P — CID 135397783
3,10-diaza-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 135397783) has the molecular formula C10H7N2P and a molecular weight of 186.15 g/mol. Its IUPAC name is 3,10-diaza-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 3,10-diaza-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 135397783 |
| Molecular Formula | C10H7N2P |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 3,10-diaza-8-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1cnc2c(c1)[pH]c1ncccc12 |
| InChI | InChI=1S/C10H7N2P/c1-3-7-9-8(4-2-5-11-9)13-10(7)12-6-1/h1-6,13H |
| InChIKey | VFCBAXYOLUAFGX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |