C11H8Cl2N4O3 — CID 135455380
5-[(Z)-[(2,5-dichlorophenyl)hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 135455380) has the molecular formula C11H8Cl2N4O3 and a molecular weight of 315.12 g/mol. Its IUPAC name is 5-[(Z)-[(2,5-dichlorophenyl)hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(Z)-[(2,5-dichlorophenyl)hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135455380 |
| Molecular Formula | C11H8Cl2N4O3 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-[(Z)-[(2,5-dichlorophenyl)hydrazinylidene]methyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=N\Nc2cc(Cl)ccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C11H8Cl2N4O3/c12-5-1-2-7(13)8(3-5)17-14-4-6-9(18)15-11(20)16-10(6)19/h1-4,17H,(H3,15,16,18,19,20)/b14-4- |
| InChIKey | SMDWATRBPXQENT-CPSFFCFKSA-N |
| XLogP | 1.52 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|