C11H7Cl3N4O3 — CID 135603857
6-hydroxy-5-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 135603857) has the molecular formula C11H7Cl3N4O3 and a molecular weight of 349.56 g/mol. Its IUPAC name is 6-hydroxy-5-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135603857 |
| Molecular Formula | C11H7Cl3N4O3 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 6-hydroxy-5-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=N/Nc2c(Cl)cc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C11H7Cl3N4O3/c12-4-1-6(13)8(7(14)2-4)18-15-3-5-9(19)16-11(21)17-10(5)20/h1-3,18H,(H3,16,17,19,20,21)/b15-3+ |
| InChIKey | KWCPIQGMGSYTIO-CRKCGEKBSA-N |
| XLogP | 2.17 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|