C14H24N4NiO4+2 — CID 135472010
dihydroxy(oxo)azanium;3-[3-[(2-hydroxyphenyl)methylideneamino]propyl-methylamino]propylazanide;nickel(2+) (PubChem CID 135472010) has the molecular formula C14H24N4NiO4+2 and a molecular weight of 371.06 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;3-[3-[(2-hydroxyphenyl)methylideneamino]propyl-methylamino]propylazanide;nickel(2+).
| Compound Name | dihydroxy(oxo)azanium;3-[3-[(2-hydroxyphenyl)methylideneamino]propyl-methylamino]propylazanide;nickel(2+) |
|---|---|
| PubChem CID | 135472010 |
| Molecular Formula | C14H24N4NiO4+2 |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | dihydroxy(oxo)azanium;3-[3-[(2-hydroxyphenyl)methylideneamino]propyl-methylamino]propylazanide;nickel(2+) |
| SMILES | CN(CCC[NH-])CCC/N=C/c1ccccc1O.O=[N+](O)O.[Ni+2] |
| InChI | InChI=1S/C14H22N3O.H2NO3.Ni/c1-17(10-4-8-15)11-5-9-16-12-13-6-2-3-7-14(13)18;2-1(3)4;/h2-3,6-7,12,15,18H,4-5,8-11H2,1H3;(H2,2,3,4);/q-1;+1;+2/b16-12+;; |
| InChIKey | FEHAMNONPGWFMG-LPMXOWGUSA-N |
| XLogP | 2.12 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|