C31H31N2O4S3+ — CID 135487830
3-[2-[(E)-[3-ethyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-2-ylidene]methyl]-4-phenyl-1,3-thiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 135487830) has the molecular formula C31H31N2O4S3+ and a molecular weight of 591.80 g/mol. Its IUPAC name is 3-[2-[(E)-[3-ethyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-2-ylidene]methyl]-4-phenyl-1,3-thiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-[3-ethyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-2-ylidene]methyl]-4-phenyl-1,3-thiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 135487830 |
| Molecular Formula | C31H31N2O4S3+ |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 3-[2-[(E)-[3-ethyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzothiazol-2-ylidene]methyl]-4-phenyl-1,3-thiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C\c2scc(-c3ccccc3)[n+]2CCCS(=O)(=O)O)Sc2cc(/C=C/c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C31H30N2O4S3/c1-3-32-27-17-14-24(11-10-23-12-15-26(37-2)16-13-23)20-29(27)39-31(32)21-30-33(18-7-19-40(34,35)36)28(22-38-30)25-8-5-4-6-9-25/h4-6,8-17,20-22H,3,7,18-19H2,1-2H3/p+1/b11-10+ |
| InChIKey | QQWKDCAOZJBNBC-ZHACJKMWSA-O |
| XLogP | 7.09 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|