C31H45N9O11S — CID 135513420
(4-nitrophenyl)methyl N-[2-[2-[2-[4-[(2S)-2-[(3-methylphenyl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 135513420) has the molecular formula C31H45N9O11S and a molecular weight of 751.82 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[2-[2-[2-[4-[(2S)-2-[(3-methylphenyl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[2-[2-[2-[4-[(2S)-2-[(3-methylphenyl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 135513420 |
| Molecular Formula | C31H45N9O11S |
| Molecular Weight | 751.82 g/mol |
| Exact Mass | 751.30 |
| IUPAC Name | (4-nitrophenyl)methyl N-[2-[2-[2-[4-[(2S)-2-[(3-methylphenyl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | Cc1cccc(S(=O)(=O)N[C@@H](CCCN/C(N)=N/[N+](=O)[O-])C(=O)N2CCN(CCOCCOCCNC(=O)OCc3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C31H45N9O11S/c1-24-4-2-5-27(22-24)52(47,48)36-28(6-3-11-33-30(32)35-40(45)46)29(41)38-15-13-37(14-16-38)17-19-50-21-20-49-18-12-34-31(42)51-23-25-7-9-26(10-8-25)39(43)44/h2,4-5,7-10,22,28,36H,3,6,11-21,23H2,1H3,(H,34,42)(H3,32,33,35)/t28-/m0/s1 |
| InChIKey | LLGXQFHVJPOZQF-NDEPHWFRSA-N |
| XLogP | 0.53 |
| TPSA | 263.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.82 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|