C16H20ClN5O5 — CID 135542111
ethyl (E)-2-[[(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]-1-ethoxy-1-oxopropan-2-yl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 135542111) has the molecular formula C16H20ClN5O5 and a molecular weight of 397.82 g/mol. Its IUPAC name is ethyl (E)-2-[[(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]-1-ethoxy-1-oxopropan-2-yl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[[(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]-1-ethoxy-1-oxopropan-2-yl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135542111 |
| Molecular Formula | C16H20ClN5O5 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | ethyl (E)-2-[[(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]-1-ethoxy-1-oxopropan-2-yl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C(/C=N/Nc1ccc(Cl)nn1)C(=O)OCC)=C(\C)O |
| InChI | InChI=1S/C16H20ClN5O5/c1-4-26-15(24)11(10(3)23)8-18-12(16(25)27-5-2)9-19-21-14-7-6-13(17)20-22-14/h6-9,12,23H,4-5H2,1-3H3,(H,21,22)/b11-10+,18-8+,19-9+ |
| InChIKey | BSILPLWAXZVKQI-VASICWJXSA-N |
| XLogP | 1.93 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|