C10H18N10O4 — CID 135554457
2-amino-9-[(2R,4S,5S)-4,5-diamino-5-[diamino(aminooxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 135554457) has the molecular formula C10H18N10O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5S)-4,5-diamino-5-[diamino(aminooxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5S)-4,5-diamino-5-[diamino(aminooxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135554457 |
| Molecular Formula | C10H18N10O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-amino-9-[(2R,4S,5S)-4,5-diamino-5-[diamino(aminooxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | NOC(N)(N)[C@@]1(N)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@]1(N)O |
| InChI | InChI=1S/C10H18N10O4/c11-7-18-5-4(6(21)19-7)17-2-20(5)3-1-8(12,22)9(13,23-3)10(14,15)24-16/h2-3,22H,1,12-16H2,(H3,11,18,19,21)/t3-,8+,9+/m1/s1 |
| InChIKey | YSEHPDYYCFPPRG-JHCVZYQXSA-N |
| XLogP | -4.62 |
| TPSA | 258.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|