C13H15N5O4 — CID 137349325
2-amino-9-[(1S,2R,4S,6S,8R)-2,6-dihydroxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-1H-purin-6-one (PubChem CID 137349325) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-amino-9-[(1S,2R,4S,6S,8R)-2,6-dihydroxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,2R,4S,6S,8R)-2,6-dihydroxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137349325 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-amino-9-[(1S,2R,4S,6S,8R)-2,6-dihydroxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@@]3(O)C[C@@H]4C[C@]4(O)[C@H]3O2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15N5O4/c14-11-16-8-7(9(19)17-11)15-4-18(8)6-3-12(20)1-5-2-13(5,21)10(12)22-6/h4-6,10,20-21H,1-3H2,(H3,14,16,17,19)/t5-,6-,10+,12+,13-/m1/s1 |
| InChIKey | AFXULUSIHCQUMJ-CFFIBIDHSA-N |
| XLogP | -1.12 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |