C15H15N6O4+ — CID 135566673
5-[2-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)acetyl]-2-hydroxybenzamide (PubChem CID 135566673) has the molecular formula C15H15N6O4+ and a molecular weight of 343.32 g/mol. Its IUPAC name is 5-[2-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)acetyl]-2-hydroxybenzamide.
| Compound Name | 5-[2-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)acetyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135566673 |
| Molecular Formula | C15H15N6O4+ |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 5-[2-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)acetyl]-2-hydroxybenzamide |
| SMILES | Cn1c[n+](CC(=O)c2ccc(O)c(C(N)=O)c2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H14N6O4/c1-20-6-21(13-11(20)14(25)19-15(17)18-13)5-10(23)7-2-3-9(22)8(4-7)12(16)24/h2-4,6H,5H2,1H3,(H5-,16,17,18,19,22,23,24,25)/p+1 |
| InChIKey | RSZNPUKMOKHZOH-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|