C12H16N7O4P — CID 176583509
3-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)propoxy-imidazol-1-ylphosphinate (PubChem CID 176583509) has the molecular formula C12H16N7O4P and a molecular weight of 353.28 g/mol. Its IUPAC name is 3-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)propoxy-imidazol-1-ylphosphinate.
| Compound Name | 3-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)propoxy-imidazol-1-ylphosphinate |
|---|---|
| PubChem CID | 176583509 |
| Molecular Formula | C12H16N7O4P |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)propoxy-imidazol-1-ylphosphinate |
| SMILES | Cn1c[n+](CCCOP(=O)([O-])n2ccnc2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C12H16N7O4P/c1-17-8-18(10-9(17)11(20)16-12(13)15-10)4-2-6-23-24(21,22)19-5-3-14-7-19/h3,5,7-8H,2,4,6H2,1H3,(H3-,13,15,16,20,21,22) |
| InChIKey | BRMIGRCETDNZQH-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|