C8H12N5O+ — CID 136602707
2-amino-9-ethyl-7-methyl-1H-purin-9-ium-6-one (PubChem CID 136602707) has the molecular formula C8H12N5O+ and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-amino-9-ethyl-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-ethyl-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 136602707 |
| Molecular Formula | C8H12N5O+ |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-amino-9-ethyl-7-methyl-1H-purin-9-ium-6-one |
| SMILES | CC[n+]1cn(C)c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C8H11N5O/c1-3-13-4-12(2)5-6(13)10-8(9)11-7(5)14/h4H,3H2,1-2H3,(H2-,9,10,11,14)/p+1 |
| InChIKey | YRXQFQFLQPOFSQ-UHFFFAOYSA-O |
| XLogP | -0.85 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|