C23H25N8O9P2+ — CID 148692240
[2-[[2-amino-6-oxo-7-[(2-oxo-6-phenyl-1H-pyridin-3-yl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid (PubChem CID 148692240) has the molecular formula C23H25N8O9P2+ and a molecular weight of 619.45 g/mol. Its IUPAC name is [2-[[2-amino-6-oxo-7-[(2-oxo-6-phenyl-1H-pyridin-3-yl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid.
| Compound Name | [2-[[2-amino-6-oxo-7-[(2-oxo-6-phenyl-1H-pyridin-3-yl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 148692240 |
| Molecular Formula | C23H25N8O9P2+ |
| Molecular Weight | 619.45 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | [2-[[2-amino-6-oxo-7-[(2-oxo-6-phenyl-1H-pyridin-3-yl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(Cc1ccc(-c3ccccc3)[nH]c1=O)c[n+]2COCCOP(=O)(O)OP(=O)(O)n1ccnc1 |
| InChI | InChI=1S/C23H24N8O9P2/c24-23-27-20-19(22(33)28-23)29(12-17-6-7-18(26-21(17)32)16-4-2-1-3-5-16)14-30(20)15-38-10-11-39-42(36,37)40-41(34,35)31-9-8-25-13-31/h1-9,13-14H,10-12,15H2,(H5-,24,26,27,28,32,33,34,35,36,37)/p+1 |
| InChIKey | NTSGXFXMEWNHPR-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 233.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|