C24H26N7O8P2+ — CID 137247459
[2-[[2-amino-6-oxo-7-[(4-phenylphenyl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid (PubChem CID 137247459) has the molecular formula C24H26N7O8P2+ and a molecular weight of 602.46 g/mol. Its IUPAC name is [2-[[2-amino-6-oxo-7-[(4-phenylphenyl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid.
| Compound Name | [2-[[2-amino-6-oxo-7-[(4-phenylphenyl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 137247459 |
| Molecular Formula | C24H26N7O8P2+ |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [2-[[2-amino-6-oxo-7-[(4-phenylphenyl)methyl]-1H-purin-9-ium-9-yl]methoxy]ethoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(Cc1ccc(-c3ccccc3)cc1)c[n+]2COCCOP(=O)(O)OP(=O)(O)n1ccnc1 |
| InChI | InChI=1S/C24H25N7O8P2/c25-24-27-22-21(23(32)28-24)29(14-18-6-8-20(9-7-18)19-4-2-1-3-5-19)16-30(22)17-37-12-13-38-41(35,36)39-40(33,34)31-11-10-26-15-31/h1-11,15-16H,12-14,17H2,(H4-,25,27,28,32,33,34,35,36)/p+1 |
| InChIKey | LWFASHZLZWVADK-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 200.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|