C22H25BN7O7P — CID 136784484
[(3aR,4R,6R,6aS)-4-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methoxy-imidazol-1-ylphosphinate (PubChem CID 136784484) has the molecular formula C22H25BN7O7P and a molecular weight of 541.27 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-4-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methoxy-imidazol-1-ylphosphinate.
| Compound Name | [(3aR,4R,6R,6aS)-4-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methoxy-imidazol-1-ylphosphinate |
|---|---|
| PubChem CID | 136784484 |
| Molecular Formula | C22H25BN7O7P |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | [(3aR,4R,6R,6aS)-4-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methoxy-imidazol-1-ylphosphinate |
| SMILES | CN(C)c1nc2c(c(=O)[nH]1)n(C)c[n+]2[C@@H]1O[C@H](COP(=O)([O-])n2ccnc2)[C@H]2OB(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C22H25BN7O7P/c1-27(2)22-25-19-16(20(31)26-22)28(3)13-30(19)21-18-17(36-23(37-18)14-7-5-4-6-8-14)15(35-21)11-34-38(32,33)29-10-9-24-12-29/h4-10,12-13,15,17-18,21H,11H2,1-3H3,(H-,25,26,31,32,33)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | BUJGLMPAEWHHBD-QTQZEZTPSA-N |
| XLogP | -1.08 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|