C13H16N2O — CID 135697564
(4aS,9bS)-N-ethyl-4,4a,5,9b-tetrahydro-1H-indeno[1,2-d][1,3]oxazin-2-imine (PubChem CID 135697564) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (4aS,9bS)-N-ethyl-4,4a,5,9b-tetrahydro-1H-indeno[1,2-d][1,3]oxazin-2-imine.
| Compound Name | (4aS,9bS)-N-ethyl-4,4a,5,9b-tetrahydro-1H-indeno[1,2-d][1,3]oxazin-2-imine |
|---|---|
| PubChem CID | 135697564 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (4aS,9bS)-N-ethyl-4,4a,5,9b-tetrahydro-1H-indeno[1,2-d][1,3]oxazin-2-imine |
| SMILES | CC/N=C1/N[C@@H]2c3ccccc3C[C@@H]2CO1 |
| InChI | InChI=1S/C13H16N2O/c1-2-14-13-15-12-10(8-16-13)7-9-5-3-4-6-11(9)12/h3-6,10,12H,2,7-8H2,1H3,(H,14,15)/t10-,12+/m1/s1 |
| InChIKey | WBDISORXHKWYDG-PWSUYJOCSA-N |
| XLogP | 1.90 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|