C13H14N4 — CID 135799858
(6-phenyldiazenylcyclohexa-2,4-dien-1-ylidene)methylhydrazine (PubChem CID 135799858) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is (6-phenyldiazenylcyclohexa-2,4-dien-1-ylidene)methylhydrazine.
| Compound Name | (6-phenyldiazenylcyclohexa-2,4-dien-1-ylidene)methylhydrazine |
|---|---|
| PubChem CID | 135799858 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (6-phenyldiazenylcyclohexa-2,4-dien-1-ylidene)methylhydrazine |
| SMILES | NNC=C1C=CC=CC1/N=N/c1ccccc1 |
| InChI | InChI=1S/C13H14N4/c14-15-10-11-6-4-5-9-13(11)17-16-12-7-2-1-3-8-12/h1-10,13,15H,14H2/b11-10?,17-16+ |
| InChIKey | PRNGBELGQIGDGO-VKSPINHISA-N |
| XLogP | 2.61 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|