C12H11Cl2N3Zn — CID 159688533
zinc;6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;dichloride (PubChem CID 159688533) has the molecular formula C12H11Cl2N3Zn and a molecular weight of 333.54 g/mol. Its IUPAC name is zinc;6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;dichloride.
| Compound Name | zinc;6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;dichloride |
|---|---|
| PubChem CID | 159688533 |
| Molecular Formula | C12H11Cl2N3Zn |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | zinc;6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;dichloride |
| SMILES | [Cl-].[Cl-].[N-]=[N+]=C1C=CC=CC1Nc1ccccc1.[Zn+2] |
| InChI | InChI=1S/C12H11N3.2ClH.Zn/c13-15-12-9-5-4-8-11(12)14-10-6-2-1-3-7-10;;;/h1-9,11,14H;2*1H;/q;;;+2/p-2 |
| InChIKey | MWCPHACLVFHANC-UHFFFAOYSA-L |
| XLogP | -3.73 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|