C14H14F2N2OS — CID 135989600
5-cyclopentyl-2-(2,4-difluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135989600) has the molecular formula C14H14F2N2OS and a molecular weight of 296.34 g/mol. Its IUPAC name is 5-cyclopentyl-2-(2,4-difluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-cyclopentyl-2-(2,4-difluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989600 |
| Molecular Formula | C14H14F2N2OS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-cyclopentyl-2-(2,4-difluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(F)cc2F)SC1C1CCCC1 |
| InChI | InChI=1S/C14H14F2N2OS/c15-9-5-6-11(10(16)7-9)17-14-18-13(19)12(20-14)8-3-1-2-4-8/h5-8,12H,1-4H2,(H,17,18,19) |
| InChIKey | MSEMHKHXQDJLEA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|