C8H12N4O — CID 136410919
9-propyl-7,8-dihydro-1H-purin-6-one (PubChem CID 136410919) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 9-propyl-7,8-dihydro-1H-purin-6-one.
| Compound Name | 9-propyl-7,8-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 136410919 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 9-propyl-7,8-dihydro-1H-purin-6-one |
| SMILES | CCCN1CNC2=C1N=CNC2=O |
| InChI | InChI=1S/C8H12N4O/c1-2-3-12-5-11-6-7(12)9-4-10-8(6)13/h4,11H,2-3,5H2,1H3,(H,9,10,13) |
| InChIKey | GEYUENSLNOJWHU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 56.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 295 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |