C18H23N3O3S — CID 136639652
5-amino-4-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-2-methylphenol (PubChem CID 136639652) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-amino-4-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-2-methylphenol.
| Compound Name | 5-amino-4-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-2-methylphenol |
|---|---|
| PubChem CID | 136639652 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-amino-4-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-2-methylphenol |
| SMILES | Cc1cc(/N=N/c2cc(S(=O)(=O)C(C)C)c(C)cc2C)c(N)cc1O |
| InChI | InChI=1S/C18H23N3O3S/c1-10(2)25(23,24)18-9-15(11(3)6-13(18)5)20-21-16-7-12(4)17(22)8-14(16)19/h6-10,22H,19H2,1-5H3/b21-20+ |
| InChIKey | LDUMLKVWXGUEOX-QZQOTICOSA-N |
| XLogP | 4.50 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|